| IPAD-DB ID | S00198 |
| Name | TCEP |
| Category | Synthetic compounds |
| 2D Structure |
|
| 3D Structure | |
| Molecular Formula | C 9 H 1 5 O 6 P |
| Molecular Weight | 250.19 g/mol |
| IUPAC Name | 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid |
| InChI | InChI=1S/C9H15O6P/c10-7(11)1-4-16(5-2-8(12)13)6-3-9(14)15/h1-6H2, (H, 10, 11)(H, 12, 13)(H, 14, 15) |
| InChIKey | PZBFGYYEXUXCOF-UHFFFAOYSA-N |
| Canonical SMILES | C(CP(CCC(=O)O)CCC(=O)O)C(=O)O |
| PubChem CID | 119411 |
| DrugBank Accession Number | - |
| CAS Registry Number | 5961-85-3 |
| Molecular Weight(Computed by SwissADME) | 250.19 |
| Hac(Computed by SwissADME) | 16 |
| Volume(Computed by ADMETlab 2.0) | 228.88 |
| Density(Computed by ADMETlab 2.0) | 1.093 |
| nRing(Computed by ADMETlab 2.0) | 0 |
| MaxRing(Computed by ADMETlab 2.0) | 0 |
| nHet(Computed by ADMETlab 2.0) | 7 |
| fChar(Computed by ADMETlab 2.0) | 0 |
| nRig(Computed by ADMETlab 2.0) | 3 |
| Flexibility(Computed by ADMETlab 2.0) | 3 |
| Stero Centers(Computed by ADMETlab 2.0) | 0 |
| LogS(Computed by ADMETlab 2.0) | -0.468 |
| LogD(Computed by ADMETlab 2.0) | -0.43 |
| logP(Computed by ADMETlab 2.0) | -1.819 |
| TPSA(Computed by SwissADME) | 125.49 |
| Hbond Acceptor(Computed by SwissADME) | 6 |
| Hbond Donor(Computed by SwissADME) | 3 |
| Rotatable Bonds(Computed by SwissADME) | 9 |
| GI Absorption(Computed by SwissADME) | High |
| BBB(blood-brain barrier) Permeant(Computed by SwissADME) | No |
| P-gp Substrate(Computed by SwissADME) | No |
| CYP1A2 Inhibitor(Computed by SwissADME) | No |
| CYP2C19 Inhibitor(Computed by SwissADME) | No |
| CYP2C9 Inhibitor(Computed by SwissADME) | No |
| CYP2D6 Inhibitor(Computed by SwissADME) | No |
| CYP3A4 Inhibitor(Computed by SwissADME) | No |
| log Kp(Skin Permeation)(Computed by SwissADME) | -8.94 |
| Lipinski(Computed by SwissADME) | 0 |
| Ghose(Computed by SwissADME) | 0 |
| Veber(Computed by SwissADME) | 0 |
| Egan(Computed by SwissADME) | 0 |
| Muegge(Computed by SwissADME) | 0 |
| Bioavailability Score(Computed by SwissADME) | 0.56 |