| IPAD-DB ID | S00127 |
| Name | N1-((7-Methoxybenzo[d][1, 3]dioxol-5-yl)methyl)-N7-(1, 2, 3, 4-tetrahydroacridin-9-yl)heptane-1, 7-diamine |
| Category | Synthetic compounds |
| 2D Structure |
|
| 3D Structure | |
| Molecular Formula | C 2 9 H 3 7 N 3 O 3 |
| Molecular Weight | 475.6 g/mol |
| IUPAC Name | N-[(7-methoxy-1, 3-benzodioxol-5-yl)methyl]-N'-(1, 2, 3, 4-tetrahydroacridin-9-yl)heptane-1, 7-diamine |
| InChI | InChI=1S/C29H37N3O3/c1-33-26-17-21(18-27-29(26)35-20-34-27)19-30-15-9-3-2-4-10-16-31-28-22-11-5-7-13-24(22)32-25-14-8-6-12-23(25)28/h5, 7, 11, 13, 17-18, 30H, 2-4, 6, 8-10, 12, 14-16, 19-20H2, 1H3, (H, 31, 32) |
| InChIKey | RGFAIITZKKYFDU-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC(=CC2=C1OCO2)CNCCCCCCCNC3=C4CCCCC4=NC5=CC=CC=C53 |
| PubChem CID | 53317863 |
| DrugBank Accession Number | - |
| CAS Registry Number | - |
| Molecular Weight(Computed by SwissADME) | 475.62 |
| Hac(Computed by SwissADME) | 35 |
| Volume(Computed by ADMETlab 2.0) | 505.627 |
| Density(Computed by ADMETlab 2.0) | 0.94 |
| nRing(Computed by ADMETlab 2.0) | 5 |
| MaxRing(Computed by ADMETlab 2.0) | 14 |
| nHet(Computed by ADMETlab 2.0) | 6 |
| fChar(Computed by ADMETlab 2.0) | 0 |
| nRig(Computed by ADMETlab 2.0) | 27 |
| Flexibility(Computed by ADMETlab 2.0) | 0.407 |
| Stero Centers(Computed by ADMETlab 2.0) | 0 |
| LogS(Computed by ADMETlab 2.0) | -5.597 |
| LogD(Computed by ADMETlab 2.0) | 3.705 |
| logP(Computed by ADMETlab 2.0) | 6.211 |
| TPSA(Computed by SwissADME) | 64.64 |
| Hbond Acceptor(Computed by SwissADME) | 5 |
| Hbond Donor(Computed by SwissADME) | 2 |
| Rotatable Bonds(Computed by SwissADME) | 12 |
| GI Absorption(Computed by SwissADME) | High |
| BBB(blood-brain barrier) Permeant(Computed by SwissADME) | No |
| P-gp Substrate(Computed by SwissADME) | Yes |
| CYP1A2 Inhibitor(Computed by SwissADME) | No |
| CYP2C19 Inhibitor(Computed by SwissADME) | Yes |
| CYP2C9 Inhibitor(Computed by SwissADME) | No |
| CYP2D6 Inhibitor(Computed by SwissADME) | Yes |
| CYP3A4 Inhibitor(Computed by SwissADME) | No |
| log Kp(Skin Permeation)(Computed by SwissADME) | -4.79 |
| Lipinski(Computed by SwissADME) | 0 |
| Ghose(Computed by SwissADME) | 3 |
| Veber(Computed by SwissADME) | 1 |
| Egan(Computed by SwissADME) | 0 |
| Muegge(Computed by SwissADME) | 1 |
| Bioavailability Score(Computed by SwissADME) | 0.55 |