| IPAD-DB ID | S00107 |
| Name | (E)-5-(4-((6-chloro-1, 2, 3, 4-tetrahydroacridin-9-yl)amino)styryl)benzene-1, 3-diol |
| Category | Synthetic compounds |
| 2D Structure |
|
| 3D Structure | |
| Molecular Formula | C 2 7 H 2 3 C l N 2 O 2 |
| Molecular Weight | 442.9 g/mol |
| IUPAC Name | 5-[(E)-2-[4-[(6-chloro-1, 2, 3, 4-tetrahydroacridin-9-yl)amino]phenyl]ethenyl]benzene-1, 3-diol |
| InChI | InChI=1S/C27H23ClN2O2/c28-19-9-12-24-26(15-19)30-25-4-2-1-3-23(25)27(24)29-20-10-7-17(8-11-20)5-6-18-13-21(31)16-22(32)14-18/h5-16, 31-32H, 1-4H2, (H, 29, 30)/b6-5+ |
| InChIKey | XZNDKAUHJQWCTR-AATRIKPKSA-N |
| Canonical SMILES | C1CCC2=NC3=C(C=CC(=C3)Cl)C(=C2C1)NC4=CC=C(C=C4)C=CC5=CC(=CC(=C5)O)O |
| PubChem CID | 132278810 |
| DrugBank Accession Number | - |
| CAS Registry Number | - |
| Molecular Weight(Computed by SwissADME) | 442.94 |
| Hac(Computed by SwissADME) | 32 |
| Volume(Computed by ADMETlab 2.0) | 455.913 |
| Density(Computed by ADMETlab 2.0) | 0.97 |
| nRing(Computed by ADMETlab 2.0) | 5 |
| MaxRing(Computed by ADMETlab 2.0) | 14 |
| nHet(Computed by ADMETlab 2.0) | 5 |
| fChar(Computed by ADMETlab 2.0) | 0 |
| nRig(Computed by ADMETlab 2.0) | 30 |
| Flexibility(Computed by ADMETlab 2.0) | 0.1 |
| Stero Centers(Computed by ADMETlab 2.0) | 0 |
| LogS(Computed by ADMETlab 2.0) | -3.676 |
| LogD(Computed by ADMETlab 2.0) | 4.472 |
| logP(Computed by ADMETlab 2.0) | 6.373 |
| TPSA(Computed by SwissADME) | 65.38 |
| Hbond Acceptor(Computed by SwissADME) | 3 |
| Hbond Donor(Computed by SwissADME) | 3 |
| Rotatable Bonds(Computed by SwissADME) | 4 |
| GI Absorption(Computed by SwissADME) | Low |
| BBB(blood-brain barrier) Permeant(Computed by SwissADME) | No |
| P-gp Substrate(Computed by SwissADME) | Yes |
| CYP1A2 Inhibitor(Computed by SwissADME) | Yes |
| CYP2C19 Inhibitor(Computed by SwissADME) | Yes |
| CYP2C9 Inhibitor(Computed by SwissADME) | No |
| CYP2D6 Inhibitor(Computed by SwissADME) | Yes |
| CYP3A4 Inhibitor(Computed by SwissADME) | No |
| log Kp(Skin Permeation)(Computed by SwissADME) | -3.93 |
| Lipinski(Computed by SwissADME) | 1 |
| Ghose(Computed by SwissADME) | 2 |
| Veber(Computed by SwissADME) | 0 |
| Egan(Computed by SwissADME) | 1 |
| Muegge(Computed by SwissADME) | 1 |
| Bioavailability Score(Computed by SwissADME) | 0.55 |