| IPAD-DB ID | S00089 |
| Name | N1, N7-bis((7-methoxybenzo[d][1, 3]dioxol-5-yl)methyl)heptane-1, 7-diamine |
| Category | Synthetic compounds |
| 2D Structure |
|
| 3D Structure | |
| Molecular Formula | C 2 5 H 3 4 N 2 O 6 |
| Molecular Weight | 458.5 g/mol |
| IUPAC Name | N, N'-bis[(7-methoxy-1, 3-benzodioxol-5-yl)methyl]heptane-1, 7-diamine |
| InChI | InChI=1S/C25H34N2O6/c1-28-20-10-18(12-22-24(20)32-16-30-22)14-26-8-6-4-3-5-7-9-27-15-19-11-21(29-2)25-23(13-19)31-17-33-25/h10-13, 26-27H, 3-9, 14-17H2, 1-2H3 |
| InChIKey | FSQWGCQSCBWZSL-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC(=CC2=C1OCO2)CNCCCCCCCNCC3=CC4=C(C(=C3)OC)OCO4 |
| PubChem CID | 53484108 |
| DrugBank Accession Number | - |
| CAS Registry Number | - |
| Molecular Weight(Computed by SwissADME) | 458.55 |
| Hac(Computed by SwissADME) | 33 |
| Volume(Computed by ADMETlab 2.0) | 465.646 |
| Density(Computed by ADMETlab 2.0) | 0.984 |
| nRing(Computed by ADMETlab 2.0) | 4 |
| MaxRing(Computed by ADMETlab 2.0) | 9 |
| nHet(Computed by ADMETlab 2.0) | 8 |
| fChar(Computed by ADMETlab 2.0) | 0 |
| nRig(Computed by ADMETlab 2.0) | 20 |
| Flexibility(Computed by ADMETlab 2.0) | 0.7 |
| Stero Centers(Computed by ADMETlab 2.0) | 0 |
| LogS(Computed by ADMETlab 2.0) | -3.069 |
| LogD(Computed by ADMETlab 2.0) | 2.971 |
| logP(Computed by ADMETlab 2.0) | 3.276 |
| TPSA(Computed by SwissADME) | 79.44 |
| Hbond Acceptor(Computed by SwissADME) | 8 |
| Hbond Donor(Computed by SwissADME) | 2 |
| Rotatable Bonds(Computed by SwissADME) | 14 |
| GI Absorption(Computed by SwissADME) | High |
| BBB(blood-brain barrier) Permeant(Computed by SwissADME) | No |
| P-gp Substrate(Computed by SwissADME) | Yes |
| CYP1A2 Inhibitor(Computed by SwissADME) | No |
| CYP2C19 Inhibitor(Computed by SwissADME) | Yes |
| CYP2C9 Inhibitor(Computed by SwissADME) | No |
| CYP2D6 Inhibitor(Computed by SwissADME) | Yes |
| CYP3A4 Inhibitor(Computed by SwissADME) | Yes |
| log Kp(Skin Permeation)(Computed by SwissADME) | -6.34 |
| Lipinski(Computed by SwissADME) | 0 |
| Ghose(Computed by SwissADME) | 0 |
| Veber(Computed by SwissADME) | 1 |
| Egan(Computed by SwissADME) | 0 |
| Muegge(Computed by SwissADME) | 0 |
| Bioavailability Score(Computed by SwissADME) | 0.55 |